C20H17BrF3N3O3 — CID 40942610
N-[4-bromo-3-(trifluoromethyl)phenyl]-2-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide (PubChem CID 40942610) has the molecular formula C20H17BrF3N3O3 and a molecular weight of 484.27 g/mol. Its IUPAC name is N-[4-bromo-3-(trifluoromethyl)phenyl]-2-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide.
| Compound Name | N-[4-bromo-3-(trifluoromethyl)phenyl]-2-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 40942610 |
| Molecular Formula | C20H17BrF3N3O3 |
| Molecular Weight | 484.27 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | N-[4-bromo-3-(trifluoromethyl)phenyl]-2-[(4S)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide |
| SMILES | CC[C@@]1(c2ccccc2)NC(=O)N(CC(=O)Nc2ccc(Br)c(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C20H17BrF3N3O3/c1-2-19(12-6-4-3-5-7-12)17(29)27(18(30)26-19)11-16(28)25-13-8-9-15(21)14(10-13)20(22,23)24/h3-10H,2,11H2,1H3,(H,25,28)(H,26,30)/t19-/m0/s1 |
| InChIKey | XZZAZIUGAKTBLF-IBGZPJMESA-N |
| XLogP | 4.26 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.27 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|