C24H26N4O4 — CID 17460120
N-(1-acetyl-2,3-dihydroindol-5-yl)-2-[4-ethyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 17460120) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is N-(1-acetyl-2,3-dihydroindol-5-yl)-2-[4-ethyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(1-acetyl-2,3-dihydroindol-5-yl)-2-[4-ethyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 17460120 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | N-(1-acetyl-2,3-dihydroindol-5-yl)-2-[4-ethyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CCC1(c2ccc(C)cc2)NC(=O)N(CC(=O)Nc2ccc3c(c2)CCN3C(C)=O)C1=O |
| InChI | InChI=1S/C24H26N4O4/c1-4-24(18-7-5-15(2)6-8-18)22(31)28(23(32)26-24)14-21(30)25-19-9-10-20-17(13-19)11-12-27(20)16(3)29/h5-10,13H,4,11-12,14H2,1-3H3,(H,25,30)(H,26,32) |
| InChIKey | DLIWEHXLTHRLMA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|