C21H21N3O3 — CID 3963316
3-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-ethyl-5-phenylimidazolidine-2,4-dione (PubChem CID 3963316) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 3-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-ethyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | 3-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-ethyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 3963316 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 3-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-ethyl-5-phenylimidazolidine-2,4-dione |
| SMILES | CCC1(c2ccccc2)NC(=O)N(CC(=O)N2CCc3ccccc32)C1=O |
| InChI | InChI=1S/C21H21N3O3/c1-2-21(16-9-4-3-5-10-16)19(26)24(20(27)22-21)14-18(25)23-13-12-15-8-6-7-11-17(15)23/h3-11H,2,12-14H2,1H3,(H,22,27) |
| InChIKey | HBEPZSVFWDPFTH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|