C26H23N3O3 — CID 2099184
(5R)-5-benzyl-3-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 2099184) has the molecular formula C26H23N3O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is (5R)-5-benzyl-3-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-benzyl-3-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2099184 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | (5R)-5-benzyl-3-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | O=C1N[C@](Cc2ccccc2)(c2ccccc2)C(=O)N1CC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C26H23N3O3/c30-23(28-16-15-20-11-7-8-14-22(20)28)18-29-24(31)26(27-25(29)32,21-12-5-2-6-13-21)17-19-9-3-1-4-10-19/h1-14H,15-18H2,(H,27,32)/t26-/m1/s1 |
| InChIKey | LMJHRHOJDJSRAJ-AREMUKBSSA-N |
| XLogP | 3.27 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|