C25H29N3O3 — CID 7240320
(5R)-5-benzyl-3-[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 7240320) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is (5R)-5-benzyl-3-[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-benzyl-3-[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7240320 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | (5R)-5-benzyl-3-[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | C[C@@H]1C[C@@H](C)CN(C(=O)CN2C(=O)N[C@](Cc3ccccc3)(c3ccccc3)C2=O)C1 |
| InChI | InChI=1S/C25H29N3O3/c1-18-13-19(2)16-27(15-18)22(29)17-28-23(30)25(26-24(28)31,21-11-7-4-8-12-21)14-20-9-5-3-6-10-20/h3-12,18-19H,13-17H2,1-2H3,(H,26,31)/t18-,19-,25-/m1/s1 |
| InChIKey | BWIKYKVXNNZXEQ-MPCDZSKCSA-N |
| XLogP | 3.18 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|