C24H29N3O3 — CID 2667132
2-[(4S)-4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N,N-di(propan-2-yl)acetamide (PubChem CID 2667132) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is 2-[(4S)-4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N,N-di(propan-2-yl)acetamide.
| Compound Name | 2-[(4S)-4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N,N-di(propan-2-yl)acetamide |
|---|---|
| PubChem CID | 2667132 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 2-[(4S)-4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N,N-di(propan-2-yl)acetamide |
| SMILES | CC(C)N(C(=O)CN1C(=O)N[C@@](Cc2ccccc2)(c2ccccc2)C1=O)C(C)C |
| InChI | InChI=1S/C24H29N3O3/c1-17(2)27(18(3)4)21(28)16-26-22(29)24(25-23(26)30,20-13-9-6-10-14-20)15-19-11-7-5-8-12-19/h5-14,17-18H,15-16H2,1-4H3,(H,25,30)/t24-/m0/s1 |
| InChIKey | QYKTWAOMVUVDOI-DEOSSOPVSA-N |
| XLogP | 3.32 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|