C26H28N4O3 — CID 43016293
2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(1-cyanocyclohexyl)-N-methylacetamide (PubChem CID 43016293) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is 2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(1-cyanocyclohexyl)-N-methylacetamide.
| Compound Name | 2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(1-cyanocyclohexyl)-N-methylacetamide |
|---|---|
| PubChem CID | 43016293 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-(1-cyanocyclohexyl)-N-methylacetamide |
| SMILES | CN(C(=O)CN1C(=O)NC(Cc2ccccc2)(c2ccccc2)C1=O)C1(C#N)CCCCC1 |
| InChI | InChI=1S/C26H28N4O3/c1-29(25(19-27)15-9-4-10-16-25)22(31)18-30-23(32)26(28-24(30)33,21-13-7-3-8-14-21)17-20-11-5-2-6-12-20/h2-3,5-8,11-14H,4,9-10,15-18H2,1H3,(H,28,33) |
| InChIKey | WHVRTPSVJLBGKL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|