C24H27N3O3 — CID 40617195
2-[(4R)-4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-cyclohexylacetamide (PubChem CID 40617195) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 2-[(4R)-4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-cyclohexylacetamide.
| Compound Name | 2-[(4R)-4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 40617195 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 2-[(4R)-4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-cyclohexylacetamide |
| SMILES | O=C(CN1C(=O)N[C@](Cc2ccccc2)(c2ccccc2)C1=O)NC1CCCCC1 |
| InChI | InChI=1S/C24H27N3O3/c28-21(25-20-14-8-3-9-15-20)17-27-22(29)24(26-23(27)30,19-12-6-2-7-13-19)16-18-10-4-1-5-11-18/h1-2,4-7,10-13,20H,3,8-9,14-17H2,(H,25,28)(H,26,30)/t24-/m1/s1 |
| InChIKey | USMXZPWPHQNHQK-XMMPIXPASA-N |
| XLogP | 3.13 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|