C22H23N3O5S — CID 2647082
2-[(4S)-4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 2647082) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is 2-[(4S)-4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | 2-[(4S)-4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 2647082 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 2-[(4S)-4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-N-[(3S)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)N[C@@](Cc2ccccc2)(c2ccccc2)C1=O)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H23N3O5S/c26-19(23-18-11-12-31(29,30)15-18)14-25-20(27)22(24-21(25)28,17-9-5-2-6-10-17)13-16-7-3-1-4-8-16/h1-10,18H,11-15H2,(H,23,26)(H,24,28)/t18-,22-/m0/s1 |
| InChIKey | VXEJSIJFKFSDEH-AVRDEDQJSA-N |
| XLogP | 0.98 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|