C14H21N3O5S — CID 2503024
2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 2503024) has the molecular formula C14H21N3O5S and a molecular weight of 343.41 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 2503024 |
| Molecular Formula | C14H21N3O5S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)NC2(CCCCC2)C1=O)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H21N3O5S/c18-11(15-10-4-7-23(21,22)9-10)8-17-12(19)14(16-13(17)20)5-2-1-3-6-14/h10H,1-9H2,(H,15,18)(H,16,20)/t10-/m1/s1 |
| InChIKey | JBCDLKBSMZEBLY-SNVBAGLBSA-N |
| XLogP | -0.46 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|