C14H22N4O3 — CID 119450197
2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-pyrrolidin-3-ylacetamide (PubChem CID 119450197) has the molecular formula C14H22N4O3 and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-pyrrolidin-3-ylacetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-pyrrolidin-3-ylacetamide |
|---|---|
| PubChem CID | 119450197 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-pyrrolidin-3-ylacetamide |
| SMILES | O=C(CN1C(=O)NC2(CCCCC2)C1=O)NC1CCNC1 |
| InChI | InChI=1S/C14H22N4O3/c19-11(16-10-4-7-15-8-10)9-18-12(20)14(17-13(18)21)5-2-1-3-6-14/h10,15H,1-9H2,(H,16,19)(H,17,21) |
| InChIKey | XYVMKSQXNNRCRR-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|