C15H24N4O3 — CID 119425679
3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-piperidin-3-ylpropanamide (PubChem CID 119425679) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-piperidin-3-ylpropanamide.
| Compound Name | 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-piperidin-3-ylpropanamide |
|---|---|
| PubChem CID | 119425679 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-piperidin-3-ylpropanamide |
| SMILES | O=C(CCN1C(=O)NC2(CCCC2)C1=O)NC1CCCNC1 |
| InChI | InChI=1S/C15H24N4O3/c20-12(17-11-4-3-8-16-10-11)5-9-19-13(21)15(18-14(19)22)6-1-2-7-15/h11,16H,1-10H2,(H,17,20)(H,18,22) |
| InChIKey | DNDKMORFFPQMQM-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|