C16H27ClN4O3 — CID 119601938
N-[2-(aminomethyl)cyclopentyl]-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide;hydrochloride (PubChem CID 119601938) has the molecular formula C16H27ClN4O3 and a molecular weight of 358.87 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119601938 |
| Molecular Formula | C16H27ClN4O3 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide;hydrochloride |
| SMILES | Cl.NCC1CCCC1NC(=O)CCN1C(=O)NC2(CCCC2)C1=O |
| InChI | InChI=1S/C16H26N4O3.ClH/c17-10-11-4-3-5-12(11)18-13(21)6-9-20-14(22)16(19-15(20)23)7-1-2-8-16;/h11-12H,1-10,17H2,(H,18,21)(H,19,23);1H |
| InChIKey | OUWTUUBALVSJPB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|