C20H32N4O4 — CID 55952841
N-[3-(cyclohexylamino)-3-oxopropyl]-4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanamide (PubChem CID 55952841) has the molecular formula C20H32N4O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-[3-(cyclohexylamino)-3-oxopropyl]-4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanamide.
| Compound Name | N-[3-(cyclohexylamino)-3-oxopropyl]-4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanamide |
|---|---|
| PubChem CID | 55952841 |
| Molecular Formula | C20H32N4O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | N-[3-(cyclohexylamino)-3-oxopropyl]-4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanamide |
| SMILES | O=C(CCCN1C(=O)NC2(CCCC2)C1=O)NCCC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C20H32N4O4/c25-16(21-13-10-17(26)22-15-7-2-1-3-8-15)9-6-14-24-18(27)20(23-19(24)28)11-4-5-12-20/h15H,1-14H2,(H,21,25)(H,22,26)(H,23,28) |
| InChIKey | RQEUAFQUKUGOGC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|