C19H30N4O5 — CID 31844794
ethyl 4-[3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanoylamino]piperidine-1-carboxylate (PubChem CID 31844794) has the molecular formula C19H30N4O5 and a molecular weight of 394.47 g/mol. Its IUPAC name is ethyl 4-[3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 31844794 |
| Molecular Formula | C19H30N4O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | ethyl 4-[3-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CCN2C(=O)NC3(CCCCC3)C2=O)CC1 |
| InChI | InChI=1S/C19H30N4O5/c1-2-28-18(27)22-11-6-14(7-12-22)20-15(24)8-13-23-16(25)19(21-17(23)26)9-4-3-5-10-19/h14H,2-13H2,1H3,(H,20,24)(H,21,26) |
| InChIKey | AIPJSJYKZBYZBP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|