C16H19N3O5S — CID 2646971
N-[(3R)-1,1-dioxothiolan-3-yl]-2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide (PubChem CID 2646971) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is N-[(3R)-1,1-dioxothiolan-3-yl]-2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide.
| Compound Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 2646971 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | N-[(3R)-1,1-dioxothiolan-3-yl]-2-[(4R)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetamide |
| SMILES | C[C@]1(c2ccccc2)NC(=O)N(CC(=O)N[C@@H]2CCS(=O)(=O)C2)C1=O |
| InChI | InChI=1S/C16H19N3O5S/c1-16(11-5-3-2-4-6-11)14(21)19(15(22)18-16)9-13(20)17-12-7-8-25(23,24)10-12/h2-6,12H,7-10H2,1H3,(H,17,20)(H,18,22)/t12-,16-/m1/s1 |
| InChIKey | QPUKZCDYEOSXCT-MLGOLLRUSA-N |
| XLogP | -0.24 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|