C20H23FN4O3 — CID 51435462
N-(1-cyanocyclohexyl)-2-[(4R)-4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-methylacetamide (PubChem CID 51435462) has the molecular formula C20H23FN4O3 and a molecular weight of 386.43 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2-[(4R)-4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-methylacetamide.
| Compound Name | N-(1-cyanocyclohexyl)-2-[(4R)-4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 51435462 |
| Molecular Formula | C20H23FN4O3 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2-[(4R)-4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-methylacetamide |
| SMILES | CN(C(=O)CN1C(=O)N[C@](C)(c2ccc(F)cc2)C1=O)C1(C#N)CCCCC1 |
| InChI | InChI=1S/C20H23FN4O3/c1-19(14-6-8-15(21)9-7-14)17(27)25(18(28)23-19)12-16(26)24(2)20(13-22)10-4-3-5-11-20/h6-9H,3-5,10-12H2,1-2H3,(H,23,28)/t19-/m1/s1 |
| InChIKey | PATUVMMSOWXJHT-LJQANCHMSA-N |
| XLogP | 2.28 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|