C18H23FN4O3 — CID 119444473
2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-methyl-N-piperidin-4-ylacetamide (PubChem CID 119444473) has the molecular formula C18H23FN4O3 and a molecular weight of 362.41 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-methyl-N-piperidin-4-ylacetamide.
| Compound Name | 2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-methyl-N-piperidin-4-ylacetamide |
|---|---|
| PubChem CID | 119444473 |
| Molecular Formula | C18H23FN4O3 |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-methyl-N-piperidin-4-ylacetamide |
| SMILES | CN(C(=O)CN1C(=O)NC(C)(c2ccc(F)cc2)C1=O)C1CCNCC1 |
| InChI | InChI=1S/C18H23FN4O3/c1-18(12-3-5-13(19)6-4-12)16(25)23(17(26)21-18)11-15(24)22(2)14-7-9-20-10-8-14/h3-6,14,20H,7-11H2,1-2H3,(H,21,26) |
| InChIKey | JCFRLPRFJIZKDW-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|