C16H18FN3O5 — CID 119362736
3-[[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]-methylamino]propanoic acid (PubChem CID 119362736) has the molecular formula C16H18FN3O5 and a molecular weight of 351.33 g/mol. Its IUPAC name is 3-[[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]-methylamino]propanoic acid.
| Compound Name | 3-[[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 119362736 |
| Molecular Formula | C16H18FN3O5 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 3-[[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]-methylamino]propanoic acid |
| SMILES | CN(CCC(=O)O)C(=O)CN1C(=O)NC(C)(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C16H18FN3O5/c1-16(10-3-5-11(17)6-4-10)14(24)20(15(25)18-16)9-12(21)19(2)8-7-13(22)23/h3-6H,7-9H2,1-2H3,(H,18,25)(H,22,23) |
| InChIKey | SQIRFCAOGRIDQY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|