C14H16ClN3O3 — CID 2097186
2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N,N-dimethylacetamide (PubChem CID 2097186) has the molecular formula C14H16ClN3O3 and a molecular weight of 309.75 g/mol. Its IUPAC name is 2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 2097186 |
| Molecular Formula | C14H16ClN3O3 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1C(=O)N[C@@](C)(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C14H16ClN3O3/c1-14(9-4-6-10(15)7-5-9)12(20)18(13(21)16-14)8-11(19)17(2)3/h4-7H,8H2,1-3H3,(H,16,21)/t14-/m0/s1 |
| InChIKey | VCVAUDJBUOJEIJ-AWEZNQCLSA-N |
| XLogP | 1.20 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|