C13H13ClN4O4 — CID 2691171
N-carbamoyl-2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 2691171) has the molecular formula C13H13ClN4O4 and a molecular weight of 324.72 g/mol. Its IUPAC name is N-carbamoyl-2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-carbamoyl-2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 2691171 |
| Molecular Formula | C13H13ClN4O4 |
| Molecular Weight | 324.72 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | N-carbamoyl-2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | C[C@@]1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)NC(N)=O)C1=O |
| InChI | InChI=1S/C13H13ClN4O4/c1-13(7-2-4-8(14)5-3-7)10(20)18(12(22)17-13)6-9(19)16-11(15)21/h2-5H,6H2,1H3,(H,17,22)(H3,15,16,19,21)/t13-/m0/s1 |
| InChIKey | XFCHAVSXYSTRSF-ZDUSSCGKSA-N |
| XLogP | 0.30 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.72 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|