C20H18ClN5O5 — CID 2570395
5-[[2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzene-1,3-dicarboxamide (PubChem CID 2570395) has the molecular formula C20H18ClN5O5 and a molecular weight of 443.85 g/mol. Its IUPAC name is 5-[[2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzene-1,3-dicarboxamide.
| Compound Name | 5-[[2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 2570395 |
| Molecular Formula | C20H18ClN5O5 |
| Molecular Weight | 443.85 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 5-[[2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzene-1,3-dicarboxamide |
| SMILES | C[C@@]1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)Nc2cc(C(N)=O)cc(C(N)=O)c2)C1=O |
| InChI | InChI=1S/C20H18ClN5O5/c1-20(12-2-4-13(21)5-3-12)18(30)26(19(31)25-20)9-15(27)24-14-7-10(16(22)28)6-11(8-14)17(23)29/h2-8H,9H2,1H3,(H2,22,28)(H2,23,29)(H,24,27)(H,25,31)/t20-/m0/s1 |
| InChIKey | QXMAMXKZLUUWGW-FQEVSTJZSA-N |
| XLogP | 0.94 |
| TPSA | 164.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.85 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|