C18H17N5O6 — CID 24572395
5-[[2-[4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzene-1,3-dicarboxamide (PubChem CID 24572395) has the molecular formula C18H17N5O6 and a molecular weight of 399.36 g/mol. Its IUPAC name is 5-[[2-[4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzene-1,3-dicarboxamide.
| Compound Name | 5-[[2-[4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 24572395 |
| Molecular Formula | C18H17N5O6 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 5-[[2-[4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]benzene-1,3-dicarboxamide |
| SMILES | CC1(c2ccco2)NC(=O)N(CC(=O)Nc2cc(C(N)=O)cc(C(N)=O)c2)C1=O |
| InChI | InChI=1S/C18H17N5O6/c1-18(12-3-2-4-29-12)16(27)23(17(28)22-18)8-13(24)21-11-6-9(14(19)25)5-10(7-11)15(20)26/h2-7H,8H2,1H3,(H2,19,25)(H2,20,26)(H,21,24)(H,22,28) |
| InChIKey | VYQILRQSNYPUCW-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 177.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|