C16H13Cl2N3O4 — CID 27109399
N-(2,3-dichlorophenyl)-2-[(4S)-4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 27109399) has the molecular formula C16H13Cl2N3O4 and a molecular weight of 382.20 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-[(4S)-4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-[(4S)-4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 27109399 |
| Molecular Formula | C16H13Cl2N3O4 |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-[(4S)-4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | C[C@@]1(c2ccco2)NC(=O)N(CC(=O)Nc2cccc(Cl)c2Cl)C1=O |
| InChI | InChI=1S/C16H13Cl2N3O4/c1-16(11-6-3-7-25-11)14(23)21(15(24)20-16)8-12(22)19-10-5-2-4-9(17)13(10)18/h2-7H,8H2,1H3,(H,19,22)(H,20,24)/t16-/m0/s1 |
| InChIKey | HHAGSJNRHDCMKC-INIZCTEOSA-N |
| XLogP | 2.99 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|