C17H15F2N3O4S — CID 51317465
N-[2-(difluoromethylsulfanyl)phenyl]-2-[4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 51317465) has the molecular formula C17H15F2N3O4S and a molecular weight of 395.39 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfanyl)phenyl]-2-[4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[2-(difluoromethylsulfanyl)phenyl]-2-[4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 51317465 |
| Molecular Formula | C17H15F2N3O4S |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | N-[2-(difluoromethylsulfanyl)phenyl]-2-[4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CC1(c2ccco2)NC(=O)N(CC(=O)Nc2ccccc2SC(F)F)C1=O |
| InChI | InChI=1S/C17H15F2N3O4S/c1-17(12-7-4-8-26-12)14(24)22(16(25)21-17)9-13(23)20-10-5-2-3-6-11(10)27-15(18)19/h2-8,15H,9H2,1H3,(H,20,23)(H,21,25) |
| InChIKey | YPOWBAMUYDSQGD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|