C23H19F2N3O3S — CID 24592823
N-[2-(difluoromethylsulfanyl)phenyl]-2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 24592823) has the molecular formula C23H19F2N3O3S and a molecular weight of 455.49 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfanyl)phenyl]-2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-[2-(difluoromethylsulfanyl)phenyl]-2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 24592823 |
| Molecular Formula | C23H19F2N3O3S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | N-[2-(difluoromethylsulfanyl)phenyl]-2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CC1(c2ccc3ccccc3c2)NC(=O)N(CC(=O)Nc2ccccc2SC(F)F)C1=O |
| InChI | InChI=1S/C23H19F2N3O3S/c1-23(16-11-10-14-6-2-3-7-15(14)12-16)20(30)28(22(31)27-23)13-19(29)26-17-8-4-5-9-18(17)32-21(24)25/h2-12,21H,13H2,1H3,(H,26,29)(H,27,31) |
| InChIKey | GTXHRLOCZAOLHC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|