C22H18FN3O4 — CID 167779097
N-(5-fluoro-2-hydroxyphenyl)-2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 167779097) has the molecular formula C22H18FN3O4 and a molecular weight of 407.40 g/mol. Its IUPAC name is N-(5-fluoro-2-hydroxyphenyl)-2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-(5-fluoro-2-hydroxyphenyl)-2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 167779097 |
| Molecular Formula | C22H18FN3O4 |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-(5-fluoro-2-hydroxyphenyl)-2-(4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CC1(c2ccc3ccccc3c2)NC(=O)N(CC(=O)Nc2cc(F)ccc2O)C1=O |
| InChI | InChI=1S/C22H18FN3O4/c1-22(15-7-6-13-4-2-3-5-14(13)10-15)20(29)26(21(30)25-22)12-19(28)24-17-11-16(23)8-9-18(17)27/h2-11,27H,12H2,1H3,(H,24,28)(H,25,30) |
| InChIKey | HNENIBTXRBOBNA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|