C16H12Cl3N3O4 — CID 27109354
2-[(4S)-4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 27109354) has the molecular formula C16H12Cl3N3O4 and a molecular weight of 416.65 g/mol. Its IUPAC name is 2-[(4S)-4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[(4S)-4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 27109354 |
| Molecular Formula | C16H12Cl3N3O4 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | 2-[(4S)-4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | C[C@@]1(c2ccco2)NC(=O)N(CC(=O)Nc2cc(Cl)c(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C16H12Cl3N3O4/c1-16(12-3-2-4-26-12)14(24)22(15(25)21-16)7-13(23)20-11-6-9(18)8(17)5-10(11)19/h2-6H,7H2,1H3,(H,20,23)(H,21,25)/t16-/m0/s1 |
| InChIKey | KXSCQZSSQPZZRS-INIZCTEOSA-N |
| XLogP | 3.65 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|