C18H16Cl3N3O4 — CID 60617768
2-[4-(2,5-dimethylfuran-3-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 60617768) has the molecular formula C18H16Cl3N3O4 and a molecular weight of 444.70 g/mol. Its IUPAC name is 2-[4-(2,5-dimethylfuran-3-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[4-(2,5-dimethylfuran-3-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 60617768 |
| Molecular Formula | C18H16Cl3N3O4 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 443.02 |
| IUPAC Name | 2-[4-(2,5-dimethylfuran-3-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | Cc1cc(C2(C)NC(=O)N(CC(=O)Nc3cc(Cl)c(Cl)cc3Cl)C2=O)c(C)o1 |
| InChI | InChI=1S/C18H16Cl3N3O4/c1-8-4-10(9(2)28-8)18(3)16(26)24(17(27)23-18)7-15(25)22-14-6-12(20)11(19)5-13(14)21/h4-6H,7H2,1-3H3,(H,22,25)(H,23,27) |
| InChIKey | VOLBOGFLLCHKKL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|