C14H14Cl3N3O3 — CID 7916625
2-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 7916625) has the molecular formula C14H14Cl3N3O3 and a molecular weight of 378.64 g/mol. Its IUPAC name is 2-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 7916625 |
| Molecular Formula | C14H14Cl3N3O3 |
| Molecular Weight | 378.64 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | 2-[(4R)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | CC[C@@]1(C)NC(=O)N(CC(=O)Nc2cc(Cl)c(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C14H14Cl3N3O3/c1-3-14(2)12(22)20(13(23)19-14)6-11(21)18-10-5-8(16)7(15)4-9(10)17/h4-5H,3,6H2,1-2H3,(H,18,21)(H,19,23)/t14-/m1/s1 |
| InChIKey | QIBHQKVBXCLSLL-CQSZACIVSA-N |
| XLogP | 3.31 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.64 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|