C11H15N5O3 — CID 43540466
2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(1H-pyrazol-4-yl)acetamide (PubChem CID 43540466) has the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(1H-pyrazol-4-yl)acetamide.
| Compound Name | 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(1H-pyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 43540466 |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(1H-pyrazol-4-yl)acetamide |
| SMILES | CCC1(C)NC(=O)N(CC(=O)Nc2cn[nH]c2)C1=O |
| InChI | InChI=1S/C11H15N5O3/c1-3-11(2)9(18)16(10(19)15-11)6-8(17)14-7-4-12-13-5-7/h4-5H,3,6H2,1-2H3,(H,12,13)(H,14,17)(H,15,19) |
| InChIKey | KOLBUCQNROPLOH-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|