C18H26N4O5S — CID 7916612
N-[4-(diethylsulfamoyl)phenyl]-2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 7916612) has the molecular formula C18H26N4O5S and a molecular weight of 410.50 g/mol. Its IUPAC name is N-[4-(diethylsulfamoyl)phenyl]-2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[4-(diethylsulfamoyl)phenyl]-2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 7916612 |
| Molecular Formula | C18H26N4O5S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | N-[4-(diethylsulfamoyl)phenyl]-2-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)CN2C(=O)N[C@@](C)(CC)C2=O)cc1 |
| InChI | InChI=1S/C18H26N4O5S/c1-5-18(4)16(24)22(17(25)20-18)12-15(23)19-13-8-10-14(11-9-13)28(26,27)21(6-2)7-3/h8-11H,5-7,12H2,1-4H3,(H,19,23)(H,20,25)/t18-/m0/s1 |
| InChIKey | XJHNJXBYKZLHHW-SFHVURJKSA-N |
| XLogP | 1.38 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|