C23H25FN4O7S2 — CID 97353813
N-[4-(diethylsulfamoyl)phenyl]-2-[(4S)-6-fluoro-1,1,2',5'-tetraoxospiro[2,3-dihydrothiochromene-4,4'-imidazolidine]-1'-yl]acetamide (PubChem CID 97353813) has the molecular formula C23H25FN4O7S2 and a molecular weight of 552.61 g/mol. Its IUPAC name is N-[4-(diethylsulfamoyl)phenyl]-2-[(4S)-6-fluoro-1,1,2',5'-tetraoxospiro[2,3-dihydrothiochromene-4,4'-imidazolidine]-1'-yl]acetamide.
| Compound Name | N-[4-(diethylsulfamoyl)phenyl]-2-[(4S)-6-fluoro-1,1,2',5'-tetraoxospiro[2,3-dihydrothiochromene-4,4'-imidazolidine]-1'-yl]acetamide |
|---|---|
| PubChem CID | 97353813 |
| Molecular Formula | C23H25FN4O7S2 |
| Molecular Weight | 552.61 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | N-[4-(diethylsulfamoyl)phenyl]-2-[(4S)-6-fluoro-1,1,2',5'-tetraoxospiro[2,3-dihydrothiochromene-4,4'-imidazolidine]-1'-yl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)CN2C(=O)N[C@]3(CCS(=O)(=O)c4ccc(F)cc43)C2=O)cc1 |
| InChI | InChI=1S/C23H25FN4O7S2/c1-3-27(4-2)37(34,35)17-8-6-16(7-9-17)25-20(29)14-28-21(30)23(26-22(28)31)11-12-36(32,33)19-10-5-15(24)13-18(19)23/h5-10,13H,3-4,11-12,14H2,1-2H3,(H,25,29)(H,26,31)/t23-/m0/s1 |
| InChIKey | VJGPBFHIPLDUHV-QHCPKHFHSA-N |
| XLogP | 1.42 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.61 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|