C17H19FN2O5S — CID 17411382
3'-(3,3-dimethyl-2-oxobutyl)-6-fluoro-1,1-dioxospiro[2,3-dihydrothiochromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 17411382) has the molecular formula C17H19FN2O5S and a molecular weight of 382.41 g/mol. Its IUPAC name is 3'-(3,3-dimethyl-2-oxobutyl)-6-fluoro-1,1-dioxospiro[2,3-dihydrothiochromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | 3'-(3,3-dimethyl-2-oxobutyl)-6-fluoro-1,1-dioxospiro[2,3-dihydrothiochromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 17411382 |
| Molecular Formula | C17H19FN2O5S |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 3'-(3,3-dimethyl-2-oxobutyl)-6-fluoro-1,1-dioxospiro[2,3-dihydrothiochromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | CC(C)(C)C(=O)CN1C(=O)NC2(CCS(=O)(=O)c3ccc(F)cc32)C1=O |
| InChI | InChI=1S/C17H19FN2O5S/c1-16(2,3)13(21)9-20-14(22)17(19-15(20)23)6-7-26(24,25)12-5-4-10(18)8-11(12)17/h4-5,8H,6-7,9H2,1-3H3,(H,19,23) |
| InChIKey | DBXNKQVERREGKL-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|