C20H28N4O5S — CID 55308756
N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetamide (PubChem CID 55308756) has the molecular formula C20H28N4O5S and a molecular weight of 436.53 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetamide.
| Compound Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetamide |
|---|---|
| PubChem CID | 55308756 |
| Molecular Formula | C20H28N4O5S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)CN2C(=O)NC3(CCCC3)C2=O)ccc1C |
| InChI | InChI=1S/C20H28N4O5S/c1-4-23(5-2)30(28,29)16-12-15(9-8-14(16)3)21-17(25)13-24-18(26)20(22-19(24)27)10-6-7-11-20/h8-9,12H,4-7,10-11,13H2,1-3H3,(H,21,25)(H,22,27) |
| InChIKey | VFTXLSJDNJJZFP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|