C20H26N4O6S — CID 16544867
2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)acetamide (PubChem CID 16544867) has the molecular formula C20H26N4O6S and a molecular weight of 450.52 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 16544867 |
| Molecular Formula | C20H26N4O6S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)NC3(CCCC3)C2=O)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C20H26N4O6S/c1-14-4-5-15(12-16(14)31(28,29)23-8-10-30-11-9-23)21-17(25)13-24-18(26)20(22-19(24)27)6-2-3-7-20/h4-5,12H,2-3,6-11,13H2,1H3,(H,21,25)(H,22,27) |
| InChIKey | QAYHDWGQROJZGB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|