C20H19N3O5S — CID 51644980
2-[(3S)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]-N-(4-methylsulfonylphenyl)acetamide (PubChem CID 51644980) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is 2-[(3S)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]-N-(4-methylsulfonylphenyl)acetamide.
| Compound Name | 2-[(3S)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]-N-(4-methylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 51644980 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 2-[(3S)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]-N-(4-methylsulfonylphenyl)acetamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)CN2C(=O)N[C@]3(CCc4ccccc43)C2=O)cc1 |
| InChI | InChI=1S/C20H19N3O5S/c1-29(27,28)15-8-6-14(7-9-15)21-17(24)12-23-18(25)20(22-19(23)26)11-10-13-4-2-3-5-16(13)20/h2-9H,10-12H2,1H3,(H,21,24)(H,22,26)/t20-/m0/s1 |
| InChIKey | XVYIPHZGBYLVLQ-FQEVSTJZSA-N |
| XLogP | 1.42 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|