C23H24N4O5S — CID 3912493
2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide (PubChem CID 3912493) has the molecular formula C23H24N4O5S and a molecular weight of 468.54 g/mol. Its IUPAC name is 2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 3912493 |
| Molecular Formula | C23H24N4O5S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)acetamide |
| SMILES | O=C(CN1C(=O)NC2(CCc3ccccc32)C1=O)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C23H24N4O5S/c28-20(24-17-7-9-18(10-8-17)33(31,32)26-13-3-4-14-26)15-27-21(29)23(25-22(27)30)12-11-16-5-1-2-6-19(16)23/h1-2,5-10H,3-4,11-15H2,(H,24,28)(H,25,30) |
| InChIKey | LPMBOTFJMQAOJL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|