C20H18N4O4 — CID 16552014
4-[[2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)acetyl]amino]benzamide (PubChem CID 16552014) has the molecular formula C20H18N4O4 and a molecular weight of 378.39 g/mol. Its IUPAC name is 4-[[2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)acetyl]amino]benzamide.
| Compound Name | 4-[[2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 16552014 |
| Molecular Formula | C20H18N4O4 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 4-[[2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)acetyl]amino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)CN2C(=O)NC3(CCc4ccccc43)C2=O)cc1 |
| InChI | InChI=1S/C20H18N4O4/c21-17(26)13-5-7-14(8-6-13)22-16(25)11-24-18(27)20(23-19(24)28)10-9-12-3-1-2-4-15(12)20/h1-8H,9-11H2,(H2,21,26)(H,22,25)(H,23,28) |
| InChIKey | DOFVEPBOTCXMBI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|