C19H15F2N3O3 — CID 2680838
N-(3,4-difluorophenyl)-2-[(3S)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]acetamide (PubChem CID 2680838) has the molecular formula C19H15F2N3O3 and a molecular weight of 371.34 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-[(3S)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]acetamide.
| Compound Name | N-(3,4-difluorophenyl)-2-[(3S)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]acetamide |
|---|---|
| PubChem CID | 2680838 |
| Molecular Formula | C19H15F2N3O3 |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-[(3S)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]acetamide |
| SMILES | O=C(CN1C(=O)N[C@]2(CCc3ccccc32)C1=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H15F2N3O3/c20-14-6-5-12(9-15(14)21)22-16(25)10-24-17(26)19(23-18(24)27)8-7-11-3-1-2-4-13(11)19/h1-6,9H,7-8,10H2,(H,22,25)(H,23,27)/t19-/m0/s1 |
| InChIKey | GMCXYOZGOZCLSL-IBGZPJMESA-N |
| XLogP | 2.30 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|