C19H16FN3O3 — CID 2680854
2-[(3S)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]-N-(2-fluorophenyl)acetamide (PubChem CID 2680854) has the molecular formula C19H16FN3O3 and a molecular weight of 353.35 g/mol. Its IUPAC name is 2-[(3S)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[(3S)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 2680854 |
| Molecular Formula | C19H16FN3O3 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 2-[(3S)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(CN1C(=O)N[C@]2(CCc3ccccc32)C1=O)Nc1ccccc1F |
| InChI | InChI=1S/C19H16FN3O3/c20-14-7-3-4-8-15(14)21-16(24)11-23-17(25)19(22-18(23)26)10-9-12-5-1-2-6-13(12)19/h1-8H,9-11H2,(H,21,24)(H,22,26)/t19-/m0/s1 |
| InChIKey | SAIUXSHTIRZKSO-IBGZPJMESA-N |
| XLogP | 2.16 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|