C21H19N3O4 — CID 2702812
N-(2-acetylphenyl)-2-[(3R)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]acetamide (PubChem CID 2702812) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is N-(2-acetylphenyl)-2-[(3R)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]acetamide.
| Compound Name | N-(2-acetylphenyl)-2-[(3R)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]acetamide |
|---|---|
| PubChem CID | 2702812 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-(2-acetylphenyl)-2-[(3R)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]acetamide |
| SMILES | CC(=O)c1ccccc1NC(=O)CN1C(=O)N[C@@]2(CCc3ccccc32)C1=O |
| InChI | InChI=1S/C21H19N3O4/c1-13(25)15-7-3-5-9-17(15)22-18(26)12-24-19(27)21(23-20(24)28)11-10-14-6-2-4-8-16(14)21/h2-9H,10-12H2,1H3,(H,22,26)(H,23,28)/t21-/m1/s1 |
| InChIKey | PINHGQNPGXFJMJ-OAQYLSRUSA-N |
| XLogP | 2.22 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|