C20H30N4O5S — CID 55304406
N-[3-(diethylsulfamoyl)phenyl]-2-[4-methyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 55304406) has the molecular formula C20H30N4O5S and a molecular weight of 438.55 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)phenyl]-2-[4-methyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[3-(diethylsulfamoyl)phenyl]-2-[4-methyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 55304406 |
| Molecular Formula | C20H30N4O5S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | N-[3-(diethylsulfamoyl)phenyl]-2-[4-methyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(NC(=O)CN2C(=O)NC(C)(CC(C)C)C2=O)c1 |
| InChI | InChI=1S/C20H30N4O5S/c1-6-23(7-2)30(28,29)16-10-8-9-15(11-16)21-17(25)13-24-18(26)20(5,12-14(3)4)22-19(24)27/h8-11,14H,6-7,12-13H2,1-5H3,(H,21,25)(H,22,27) |
| InChIKey | XEEFXCFINBKUEG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|