C16H19Cl2N3O3 — CID 4790490
N-(2,3-dichlorophenyl)-2-[4-methyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 4790490) has the molecular formula C16H19Cl2N3O3 and a molecular weight of 372.25 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-[4-methyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-[4-methyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 4790490 |
| Molecular Formula | C16H19Cl2N3O3 |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-[4-methyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CC(C)CC1(C)NC(=O)N(CC(=O)Nc2cccc(Cl)c2Cl)C1=O |
| InChI | InChI=1S/C16H19Cl2N3O3/c1-9(2)7-16(3)14(23)21(15(24)20-16)8-12(22)19-11-6-4-5-10(17)13(11)18/h4-6,9H,7-8H2,1-3H3,(H,19,22)(H,20,24) |
| InChIKey | LBLICIHMVGNVKT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|