C17H22FN3O3 — CID 2430195
N-(3-fluoro-4-methylphenyl)-2-[(4R)-4-methyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 2430195) has the molecular formula C17H22FN3O3 and a molecular weight of 335.38 g/mol. Its IUPAC name is N-(3-fluoro-4-methylphenyl)-2-[(4R)-4-methyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(3-fluoro-4-methylphenyl)-2-[(4R)-4-methyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 2430195 |
| Molecular Formula | C17H22FN3O3 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | N-(3-fluoro-4-methylphenyl)-2-[(4R)-4-methyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)N[C@](C)(CC(C)C)C2=O)cc1F |
| InChI | InChI=1S/C17H22FN3O3/c1-10(2)8-17(4)15(23)21(16(24)20-17)9-14(22)19-12-6-5-11(3)13(18)7-12/h5-7,10H,8-9H2,1-4H3,(H,19,22)(H,20,24)/t17-/m1/s1 |
| InChIKey | UDFZDQRBKCHKSO-QGZVFWFLSA-N |
| XLogP | 2.43 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|