C19H14Cl2F3N3O3 — CID 46484652
N-(2,3-dichlorophenyl)-2-[4-methyl-2,5-dioxo-4-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]acetamide (PubChem CID 46484652) has the molecular formula C19H14Cl2F3N3O3 and a molecular weight of 460.24 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-[4-methyl-2,5-dioxo-4-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-[4-methyl-2,5-dioxo-4-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 46484652 |
| Molecular Formula | C19H14Cl2F3N3O3 |
| Molecular Weight | 460.24 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-[4-methyl-2,5-dioxo-4-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]acetamide |
| SMILES | CC1(c2cccc(C(F)(F)F)c2)NC(=O)N(CC(=O)Nc2cccc(Cl)c2Cl)C1=O |
| InChI | InChI=1S/C19H14Cl2F3N3O3/c1-18(10-4-2-5-11(8-10)19(22,23)24)16(29)27(17(30)26-18)9-14(28)25-13-7-3-6-12(20)15(13)21/h2-8H,9H2,1H3,(H,25,28)(H,26,30) |
| InChIKey | KETWJDPLPXLEJE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.24 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|