C21H20F3N3O3 — CID 51951377
N-(3-ethylphenyl)-2-[(4R)-4-methyl-2,5-dioxo-4-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]acetamide (PubChem CID 51951377) has the molecular formula C21H20F3N3O3 and a molecular weight of 419.40 g/mol. Its IUPAC name is N-(3-ethylphenyl)-2-[(4R)-4-methyl-2,5-dioxo-4-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]acetamide.
| Compound Name | N-(3-ethylphenyl)-2-[(4R)-4-methyl-2,5-dioxo-4-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 51951377 |
| Molecular Formula | C21H20F3N3O3 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-(3-ethylphenyl)-2-[(4R)-4-methyl-2,5-dioxo-4-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]acetamide |
| SMILES | CCc1cccc(NC(=O)CN2C(=O)N[C@](C)(c3cccc(C(F)(F)F)c3)C2=O)c1 |
| InChI | InChI=1S/C21H20F3N3O3/c1-3-13-6-4-9-16(10-13)25-17(28)12-27-18(29)20(2,26-19(27)30)14-7-5-8-15(11-14)21(22,23)24/h4-11H,3,12H2,1-2H3,(H,25,28)(H,26,30)/t20-/m1/s1 |
| InChIKey | QSKXHCWPUFFVHI-HXUWFJFHSA-N |
| XLogP | 3.67 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|