C22H26N4O5S — CID 24658435
N-[3-(dimethylsulfamoyl)phenyl]-2-(2,5-dioxo-4-phenyl-4-propylimidazolidin-1-yl)acetamide (PubChem CID 24658435) has the molecular formula C22H26N4O5S and a molecular weight of 458.54 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)phenyl]-2-(2,5-dioxo-4-phenyl-4-propylimidazolidin-1-yl)acetamide.
| Compound Name | N-[3-(dimethylsulfamoyl)phenyl]-2-(2,5-dioxo-4-phenyl-4-propylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 24658435 |
| Molecular Formula | C22H26N4O5S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)phenyl]-2-(2,5-dioxo-4-phenyl-4-propylimidazolidin-1-yl)acetamide |
| SMILES | CCCC1(c2ccccc2)NC(=O)N(CC(=O)Nc2cccc(S(=O)(=O)N(C)C)c2)C1=O |
| InChI | InChI=1S/C22H26N4O5S/c1-4-13-22(16-9-6-5-7-10-16)20(28)26(21(29)24-22)15-19(27)23-17-11-8-12-18(14-17)32(30,31)25(2)3/h5-12,14H,4,13,15H2,1-3H3,(H,23,27)(H,24,29) |
| InChIKey | YILJFTUUNNCECG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|