C13H19N5O3 — CID 104619685
2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(5-ethyl-1H-pyrazol-3-yl)acetamide (PubChem CID 104619685) has the molecular formula C13H19N5O3 and a molecular weight of 293.33 g/mol. Its IUPAC name is 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(5-ethyl-1H-pyrazol-3-yl)acetamide.
| Compound Name | 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(5-ethyl-1H-pyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 104619685 |
| Molecular Formula | C13H19N5O3 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(5-ethyl-1H-pyrazol-3-yl)acetamide |
| SMILES | CCc1cc(NC(=O)CN2C(=O)NC(C)(CC)C2=O)n[nH]1 |
| InChI | InChI=1S/C13H19N5O3/c1-4-8-6-9(17-16-8)14-10(19)7-18-11(20)13(3,5-2)15-12(18)21/h6H,4-5,7H2,1-3H3,(H,15,21)(H2,14,16,17,19) |
| InChIKey | GTPTXUQOCMXMJN-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|