C11H17N3O5 — CID 43170651
3-[[2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]propanoic acid (PubChem CID 43170651) has the molecular formula C11H17N3O5 and a molecular weight of 271.27 g/mol. Its IUPAC name is 3-[[2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]propanoic acid.
| Compound Name | 3-[[2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 43170651 |
| Molecular Formula | C11H17N3O5 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 3-[[2-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]propanoic acid |
| SMILES | CCC1(C)NC(=O)N(CC(=O)NCCC(=O)O)C1=O |
| InChI | InChI=1S/C11H17N3O5/c1-3-11(2)9(18)14(10(19)13-11)6-7(15)12-5-4-8(16)17/h3-6H2,1-2H3,(H,12,15)(H,13,19)(H,16,17) |
| InChIKey | SKXZKVAMBDAROZ-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|